C26H50N2O3SSi2 — CID 135989681
2-(2-bicyclo[2.2.1]heptanylimino)-5,5-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazolidin-4-one (PubChem CID 135989681) has the molecular formula C26H50N2O3SSi2 and a molecular weight of 526.94 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylimino)-5,5-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylimino)-5,5-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989681 |
| Molecular Formula | C26H50N2O3SSi2 |
| Molecular Weight | 526.94 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylimino)-5,5-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1(CCO[Si](C)(C)C(C)(C)C)S/C(=N/C2CC3CCC2C3)NC1=O |
| InChI | InChI=1S/C26H50N2O3SSi2/c1-24(2,3)33(7,8)30-15-13-26(14-16-31-34(9,10)25(4,5)6)22(29)28-23(32-26)27-21-18-19-11-12-20(21)17-19/h19-21H,11-18H2,1-10H3,(H,27,28,29) |
| InChIKey | JJGCPPQILRGIMU-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.94 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|