C13H18N2O4S — CID 135989795
ethyl 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-1,4-dioxo-1,3-thiazolidine-5-carboxylate (PubChem CID 135989795) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is ethyl 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-1,4-dioxo-1,3-thiazolidine-5-carboxylate.
| Compound Name | ethyl 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-1,4-dioxo-1,3-thiazolidine-5-carboxylate |
|---|---|
| PubChem CID | 135989795 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | ethyl 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-1,4-dioxo-1,3-thiazolidine-5-carboxylate |
| SMILES | CCOC(=O)C1C(=O)N/C(=N/[C@H]2C[C@@H]3CC[C@H]2C3)S1=O |
| InChI | InChI=1S/C13H18N2O4S/c1-2-19-12(17)10-11(16)15-13(20(10)18)14-9-6-7-3-4-8(9)5-7/h7-10H,2-6H2,1H3,(H,14,15,16)/t7-,8+,9+,10?,20?/m1/s1 |
| InChIKey | PLEGJYIWPPMHGC-AKNGCWCSSA-N |
| XLogP | 0.34 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|