C14H22N2OS — CID 135989484
2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-tert-butyl-1,3-thiazolidin-4-one (PubChem CID 135989484) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-tert-butyl-1,3-thiazolidin-4-one.
| Compound Name | 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-tert-butyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989484 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-tert-butyl-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)C1S/C(=N/[C@H]2C[C@@H]3CC[C@H]2C3)NC1=O |
| InChI | InChI=1S/C14H22N2OS/c1-14(2,3)11-12(17)16-13(18-11)15-10-7-8-4-5-9(10)6-8/h8-11H,4-7H2,1-3H3,(H,15,16,17)/t8-,9+,10+,11?/m1/s1 |
| InChIKey | YDWVDWFGNWTUMF-LCVSCUNMSA-N |
| XLogP | 2.81 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|