C12H13F3N2OS — CID 162603197
2-(3-tricyclo[3.3.0.02,8]octanylimino)-5-(trifluoromethyl)-1,3-thiazolidin-4-one (PubChem CID 162603197) has the molecular formula C12H13F3N2OS and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-(3-tricyclo[3.3.0.02,8]octanylimino)-5-(trifluoromethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-tricyclo[3.3.0.02,8]octanylimino)-5-(trifluoromethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 162603197 |
| Molecular Formula | C12H13F3N2OS |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-(3-tricyclo[3.3.0.02,8]octanylimino)-5-(trifluoromethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\C2CC3CCC4C3C24)SC1C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2OS/c13-12(14,15)9-10(18)17-11(19-9)16-6-3-4-1-2-5-7(4)8(5)6/h4-9H,1-3H2,(H,16,17,18) |
| InChIKey | FFICUHYKZSENGU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|