C13H20N2O2 — CID 135989466
2-(2-bicyclo[2.2.1]heptanylimino)-5-propan-2-yl-1,3-oxazolidin-4-one (PubChem CID 135989466) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylimino)-5-propan-2-yl-1,3-oxazolidin-4-one.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylimino)-5-propan-2-yl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 135989466 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylimino)-5-propan-2-yl-1,3-oxazolidin-4-one |
| SMILES | CC(C)C1O/C(=N\C2CC3CCC2C3)NC1=O |
| InChI | InChI=1S/C13H20N2O2/c1-7(2)11-12(16)15-13(17-11)14-10-6-8-3-4-9(10)5-8/h7-11H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | DWUSLTPXYKAKBH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|