C22H20N2O7S — CID 135993429
ethyl 3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyloxymethyl]-1-benzofuran-2-carboxylate (PubChem CID 135993429) has the molecular formula C22H20N2O7S and a molecular weight of 456.48 g/mol. Its IUPAC name is ethyl 3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyloxymethyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyloxymethyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 135993429 |
| Molecular Formula | C22H20N2O7S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | ethyl 3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyloxymethyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1COC(=O)C(C)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C22H20N2O7S/c1-3-29-22(26)19-16(14-8-4-6-10-17(14)31-19)12-30-21(25)13(2)23-20-15-9-5-7-11-18(15)32(27,28)24-20/h4-11,13H,3,12H2,1-2H3,(H,23,24) |
| InChIKey | UEMXPRWAAZTQEE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|