C22H24F3N5O4 — CID 135994008
2-(3,5-dimethylpiperidin-1-yl)-4,7-dioxo-N-[3-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135994008) has the molecular formula C22H24F3N5O4 and a molecular weight of 479.46 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperidin-1-yl)-4,7-dioxo-N-[3-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 2-(3,5-dimethylpiperidin-1-yl)-4,7-dioxo-N-[3-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135994008 |
| Molecular Formula | C22H24F3N5O4 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-(3,5-dimethylpiperidin-1-yl)-4,7-dioxo-N-[3-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CC1CC(C)CN(c2nc3c(c(=O)[nH]2)C(C(=O)Nc2cccc(OC(F)(F)F)c2)CC(=O)N3)C1 |
| InChI | InChI=1S/C22H24F3N5O4/c1-11-6-12(2)10-30(9-11)21-28-18-17(20(33)29-21)15(8-16(31)27-18)19(32)26-13-4-3-5-14(7-13)34-22(23,24)25/h3-5,7,11-12,15H,6,8-10H2,1-2H3,(H,26,32)(H2,27,28,29,31,33) |
| InChIKey | VYMZZVGALXTCCY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |