C27H20N6O14S3 — CID 135996713
5-hydroxy-4-[[8-hydroxy-7-[(2-hydroxy-5-methoxy-4-sulfinophenyl)diazenyl]-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-1-(4-sulfophenyl)pyrazole-3-carboxylic acid (PubChem CID 135996713) has the molecular formula C27H20N6O14S3 and a molecular weight of 748.69 g/mol. Its IUPAC name is 5-hydroxy-4-[[8-hydroxy-7-[(2-hydroxy-5-methoxy-4-sulfinophenyl)diazenyl]-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-1-(4-sulfophenyl)pyrazole-3-carboxylic acid.
| Compound Name | 5-hydroxy-4-[[8-hydroxy-7-[(2-hydroxy-5-methoxy-4-sulfinophenyl)diazenyl]-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-1-(4-sulfophenyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 135996713 |
| Molecular Formula | C27H20N6O14S3 |
| Molecular Weight | 748.69 g/mol |
| Exact Mass | 748.02 |
| IUPAC Name | 5-hydroxy-4-[[8-hydroxy-7-[(2-hydroxy-5-methoxy-4-sulfinophenyl)diazenyl]-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-1-(4-sulfophenyl)pyrazole-3-carboxylic acid |
| SMILES | COc1cc(/N=N/c2c(SOOO)cc3ccc(/N=N/c4c(C(=O)O)nn(-c5ccc(S(=O)(=O)O)cc5)c4O)cc3c2O)c(O)cc1S(=O)O |
| InChI | InChI=1S/C27H20N6O14S3/c1-45-19-10-17(18(34)11-21(19)49(40)41)29-30-22-20(48-47-46-39)8-12-2-3-13(9-16(12)25(22)35)28-31-23-24(27(37)38)32-33(26(23)36)14-4-6-15(7-5-14)50(42,43)44/h2-11,34-36,39H,1H3,(H,37,38)(H,40,41)(H,42,43,44)/b30-29+,31-28+ |
| InChIKey | CMRQRAZUMQQHNN-JZXBUVORSA-N |
| XLogP | 5.94 |
| TPSA | 304.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|