C16H12ClN3O3 — CID 135998444
5-chloro-3-[(3Z)-5-hydroxy-3-hydroxyimino-1,2-dihydroindol-2-yl]-1,3-dihydroindol-2-one (PubChem CID 135998444) has the molecular formula C16H12ClN3O3 and a molecular weight of 329.74 g/mol. Its IUPAC name is 5-chloro-3-[(3Z)-5-hydroxy-3-hydroxyimino-1,2-dihydroindol-2-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-[(3Z)-5-hydroxy-3-hydroxyimino-1,2-dihydroindol-2-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 135998444 |
| Molecular Formula | C16H12ClN3O3 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 5-chloro-3-[(3Z)-5-hydroxy-3-hydroxyimino-1,2-dihydroindol-2-yl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C1C1Nc2ccc(O)cc2/C1=N/O |
| InChI | InChI=1S/C16H12ClN3O3/c17-7-1-3-11-9(5-7)13(16(22)19-11)15-14(20-23)10-6-8(21)2-4-12(10)18-15/h1-6,13,15,18,21,23H,(H,19,22)/b20-14- |
| InChIKey | QYYPXEPZRNQBBD-ZHZULCJRSA-N |
| XLogP | 2.75 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|