C27H27FN4O2 — CID 135998808
methyl 3-benzyl-6-(3-fluorophenyl)-4-methyl-2-(2-pyridin-2-ylethylimino)-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 135998808) has the molecular formula C27H27FN4O2 and a molecular weight of 458.54 g/mol. Its IUPAC name is methyl 3-benzyl-6-(3-fluorophenyl)-4-methyl-2-(2-pyridin-2-ylethylimino)-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 3-benzyl-6-(3-fluorophenyl)-4-methyl-2-(2-pyridin-2-ylethylimino)-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135998808 |
| Molecular Formula | C27H27FN4O2 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | methyl 3-benzyl-6-(3-fluorophenyl)-4-methyl-2-(2-pyridin-2-ylethylimino)-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N(Cc2ccccc2)/C(=N/CCc2ccccn2)NC1c1cccc(F)c1 |
| InChI | InChI=1S/C27H27FN4O2/c1-19-24(26(33)34-2)25(21-11-8-12-22(28)17-21)31-27(30-16-14-23-13-6-7-15-29-23)32(19)18-20-9-4-3-5-10-20/h3-13,15,17,25H,14,16,18H2,1-2H3,(H,30,31) |
| InChIKey | OTIGNIYTQKIYDO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|