C23H26BrN3O3 — CID 135693583
methyl (6S)-3-benzyl-6-(4-bromophenyl)-2-(2-methoxyethylimino)-4-methyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 135693583) has the molecular formula C23H26BrN3O3 and a molecular weight of 472.38 g/mol. Its IUPAC name is methyl (6S)-3-benzyl-6-(4-bromophenyl)-2-(2-methoxyethylimino)-4-methyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl (6S)-3-benzyl-6-(4-bromophenyl)-2-(2-methoxyethylimino)-4-methyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135693583 |
| Molecular Formula | C23H26BrN3O3 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | methyl (6S)-3-benzyl-6-(4-bromophenyl)-2-(2-methoxyethylimino)-4-methyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COCC/N=C1\N[C@@H](c2ccc(Br)cc2)C(C(=O)OC)=C(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H26BrN3O3/c1-16-20(22(28)30-3)21(18-9-11-19(24)12-10-18)26-23(25-13-14-29-2)27(16)15-17-7-5-4-6-8-17/h4-12,21H,13-15H2,1-3H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | VWURODAJFFFZOZ-NRFANRHFSA-N |
| XLogP | 4.05 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|