C23H24BrN3O2 — CID 135925270
methyl (6S)-3-benzyl-6-(4-bromophenyl)-4-methyl-2-prop-2-enylimino-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 135925270) has the molecular formula C23H24BrN3O2 and a molecular weight of 454.37 g/mol. Its IUPAC name is methyl (6S)-3-benzyl-6-(4-bromophenyl)-4-methyl-2-prop-2-enylimino-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl (6S)-3-benzyl-6-(4-bromophenyl)-4-methyl-2-prop-2-enylimino-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135925270 |
| Molecular Formula | C23H24BrN3O2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | methyl (6S)-3-benzyl-6-(4-bromophenyl)-4-methyl-2-prop-2-enylimino-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | C=CC/N=C1\N[C@@H](c2ccc(Br)cc2)C(C(=O)OC)=C(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H24BrN3O2/c1-4-14-25-23-26-21(18-10-12-19(24)13-11-18)20(22(28)29-3)16(2)27(23)15-17-8-6-5-7-9-17/h4-13,21H,1,14-15H2,2-3H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | HTFDUDVSQDRDFH-NRFANRHFSA-N |
| XLogP | 4.58 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|