C17H23FN5O4P — CID 135999155
3-[[2-ethyl-4-fluoro-5-(2-methyl-6-oxo-1H-purin-9-yl)oxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile (PubChem CID 135999155) has the molecular formula C17H23FN5O4P and a molecular weight of 411.37 g/mol. Its IUPAC name is 3-[[2-ethyl-4-fluoro-5-(2-methyl-6-oxo-1H-purin-9-yl)oxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[2-ethyl-4-fluoro-5-(2-methyl-6-oxo-1H-purin-9-yl)oxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 135999155 |
| Molecular Formula | C17H23FN5O4P |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 3-[[2-ethyl-4-fluoro-5-(2-methyl-6-oxo-1H-purin-9-yl)oxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
| SMILES | CCC1OCC(n2cnc3c(=O)[nH]c(C)nc32)C(F)C1OP(C)OCCC#N |
| InChI | InChI=1S/C17H23FN5O4P/c1-4-12-15(27-28(3)26-7-5-6-19)13(18)11(8-25-12)23-9-20-14-16(23)21-10(2)22-17(14)24/h9,11-13,15H,4-5,7-8H2,1-3H3,(H,21,22,24) |
| InChIKey | XWDVOJIYKDXWJY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|