C40H28N6O6 — CID 135999228
4-hydroxy-N-[4-[[4-hydroxy-3-[(1-hydroxynaphthalen-2-yl)diazenyl]benzoyl]amino]phenyl]-3-[(1-hydroxynaphthalen-2-yl)diazenyl]benzamide (PubChem CID 135999228) has the molecular formula C40H28N6O6 and a molecular weight of 688.70 g/mol. Its IUPAC name is 4-hydroxy-N-[4-[[4-hydroxy-3-[(1-hydroxynaphthalen-2-yl)diazenyl]benzoyl]amino]phenyl]-3-[(1-hydroxynaphthalen-2-yl)diazenyl]benzamide.
| Compound Name | 4-hydroxy-N-[4-[[4-hydroxy-3-[(1-hydroxynaphthalen-2-yl)diazenyl]benzoyl]amino]phenyl]-3-[(1-hydroxynaphthalen-2-yl)diazenyl]benzamide |
|---|---|
| PubChem CID | 135999228 |
| Molecular Formula | C40H28N6O6 |
| Molecular Weight | 688.70 g/mol |
| Exact Mass | 688.21 |
| IUPAC Name | 4-hydroxy-N-[4-[[4-hydroxy-3-[(1-hydroxynaphthalen-2-yl)diazenyl]benzoyl]amino]phenyl]-3-[(1-hydroxynaphthalen-2-yl)diazenyl]benzamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccc(O)c(/N=N/c3ccc4ccccc4c3O)c2)cc1)c1ccc(O)c(/N=N/c2ccc3ccccc3c2O)c1 |
| InChI | InChI=1S/C40H28N6O6/c47-35-19-11-25(21-33(35)45-43-31-17-9-23-5-1-3-7-29(23)37(31)49)39(51)41-27-13-15-28(16-14-27)42-40(52)26-12-20-36(48)34(22-26)46-44-32-18-10-24-6-2-4-8-30(24)38(32)50/h1-22,47-50H,(H,41,51)(H,42,52)/b45-43+,46-44+ |
| InChIKey | HRIOEQMLMKSHLN-MWOVFPFUSA-N |
| XLogP | 10.15 |
| TPSA | 188.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.70 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|