C24H28N6 — CID 136500142
N-[(Z)-aminodiazenyl]-1-(18-cyclohexyl-6,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaen-14-yl)ethenamine (PubChem CID 136500142) has the molecular formula C24H28N6 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-[(Z)-aminodiazenyl]-1-(18-cyclohexyl-6,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaen-14-yl)ethenamine.
| Compound Name | N-[(Z)-aminodiazenyl]-1-(18-cyclohexyl-6,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaen-14-yl)ethenamine |
|---|---|
| PubChem CID | 136500142 |
| Molecular Formula | C24H28N6 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N-[(Z)-aminodiazenyl]-1-(18-cyclohexyl-6,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaen-14-yl)ethenamine |
| SMILES | C=C(N/N=N\N)c1ccc2c(C3CCCCC3)c3n(c2c1)CCCc1ncccc1-3 |
| InChI | InChI=1S/C24H28N6/c1-16(27-29-28-25)18-11-12-20-22(15-18)30-14-6-10-21-19(9-5-13-26-21)24(30)23(20)17-7-3-2-4-8-17/h5,9,11-13,15,17H,1-4,6-8,10,14H2,(H2,25,29)(H,27,28) |
| InChIKey | FBGJQVMLDNMLAY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|