C24H20N4O7S3 — CID 136501398
3-[[5-amino-4-cyano-3-(4-propoxyphenyl)thiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 136501398) has the molecular formula C24H20N4O7S3 and a molecular weight of 572.65 g/mol. Its IUPAC name is 3-[[5-amino-4-cyano-3-(4-propoxyphenyl)thiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[5-amino-4-cyano-3-(4-propoxyphenyl)thiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 136501398 |
| Molecular Formula | C24H20N4O7S3 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.05 |
| IUPAC Name | 3-[[5-amino-4-cyano-3-(4-propoxyphenyl)thiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | CCCOc1ccc(-c2c(/N=N/c3cc(S(=O)(=O)O)c4cccc(S(=O)(=O)O)c4c3)sc(N)c2C#N)cc1 |
| InChI | InChI=1S/C24H20N4O7S3/c1-2-10-35-16-8-6-14(7-9-16)22-19(13-25)23(26)36-24(22)28-27-15-11-18-17(21(12-15)38(32,33)34)4-3-5-20(18)37(29,30)31/h3-9,11-12H,2,10,26H2,1H3,(H,29,30,31)(H,32,33,34)/b28-27+ |
| InChIKey | GXMHAGGOURHRGT-BYYHNAKLSA-N |
| XLogP | 5.72 |
| TPSA | 192.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|