C24H19N5O7S3 — CID 136501390
3-[[5-amino-4-cyano-3-[4-(propanoylamino)phenyl]thiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 136501390) has the molecular formula C24H19N5O7S3 and a molecular weight of 585.65 g/mol. Its IUPAC name is 3-[[5-amino-4-cyano-3-[4-(propanoylamino)phenyl]thiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[5-amino-4-cyano-3-[4-(propanoylamino)phenyl]thiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 136501390 |
| Molecular Formula | C24H19N5O7S3 |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.04 |
| IUPAC Name | 3-[[5-amino-4-cyano-3-[4-(propanoylamino)phenyl]thiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | CCC(=O)Nc1ccc(-c2c(/N=N/c3cc(S(=O)(=O)O)c4cccc(S(=O)(=O)O)c4c3)sc(N)c2C#N)cc1 |
| InChI | InChI=1S/C24H19N5O7S3/c1-2-21(30)27-14-8-6-13(7-9-14)22-18(12-25)23(26)37-24(22)29-28-15-10-17-16(20(11-15)39(34,35)36)4-3-5-19(17)38(31,32)33/h3-11H,2,26H2,1H3,(H,27,30)(H,31,32,33)(H,34,35,36)/b29-28+ |
| InChIKey | RFHOTQHUGKSFNZ-ZQHSETAFSA-N |
| XLogP | 5.28 |
| TPSA | 212.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|