C21H15Cl2N5O6S2 — CID 136501454
4-[3-[5-amino-4-cyano-2-[(2,5-dichloro-4-sulfophenyl)diazenyl]thiophen-3-yl]anilino]-4-oxobutanoic acid (PubChem CID 136501454) has the molecular formula C21H15Cl2N5O6S2 and a molecular weight of 568.42 g/mol. Its IUPAC name is 4-[3-[5-amino-4-cyano-2-[(2,5-dichloro-4-sulfophenyl)diazenyl]thiophen-3-yl]anilino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[5-amino-4-cyano-2-[(2,5-dichloro-4-sulfophenyl)diazenyl]thiophen-3-yl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 136501454 |
| Molecular Formula | C21H15Cl2N5O6S2 |
| Molecular Weight | 568.42 g/mol |
| Exact Mass | 566.98 |
| IUPAC Name | 4-[3-[5-amino-4-cyano-2-[(2,5-dichloro-4-sulfophenyl)diazenyl]thiophen-3-yl]anilino]-4-oxobutanoic acid |
| SMILES | N#Cc1c(N)sc(/N=N/c2cc(Cl)c(S(=O)(=O)O)cc2Cl)c1-c1cccc(NC(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C21H15Cl2N5O6S2/c22-13-8-16(36(32,33)34)14(23)7-15(13)27-28-21-19(12(9-24)20(25)35-21)10-2-1-3-11(6-10)26-17(29)4-5-18(30)31/h1-3,6-8H,4-5,25H2,(H,26,29)(H,30,31)(H,32,33,34)/b28-27+ |
| InChIKey | VYLJZWCVGJDCOK-BYYHNAKLSA-N |
| XLogP | 5.64 |
| TPSA | 195.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|