C22H16N6O3S — CID 136501370
[3-[3-[5-amino-4-cyano-2-[(2-cyanophenyl)diazenyl]thiophen-3-yl]anilino]-3-oxopropyl] formate (PubChem CID 136501370) has the molecular formula C22H16N6O3S and a molecular weight of 444.48 g/mol. Its IUPAC name is [3-[3-[5-amino-4-cyano-2-[(2-cyanophenyl)diazenyl]thiophen-3-yl]anilino]-3-oxopropyl] formate.
| Compound Name | [3-[3-[5-amino-4-cyano-2-[(2-cyanophenyl)diazenyl]thiophen-3-yl]anilino]-3-oxopropyl] formate |
|---|---|
| PubChem CID | 136501370 |
| Molecular Formula | C22H16N6O3S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | [3-[3-[5-amino-4-cyano-2-[(2-cyanophenyl)diazenyl]thiophen-3-yl]anilino]-3-oxopropyl] formate |
| SMILES | N#Cc1ccccc1/N=N/c1sc(N)c(C#N)c1-c1cccc(NC(=O)CCOC=O)c1 |
| InChI | InChI=1S/C22H16N6O3S/c23-11-15-4-1-2-7-18(15)27-28-22-20(17(12-24)21(25)32-22)14-5-3-6-16(10-14)26-19(30)8-9-31-13-29/h1-7,10,13H,8-9,25H2,(H,26,30)/b28-27+ |
| InChIKey | OKXAZBMHDZFLEX-BYYHNAKLSA-N |
| XLogP | 4.66 |
| TPSA | 153.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|