C21H16N6O5S2 — CID 136680538
2-[[3-cyano-5-[(2-cyano-4-nitrophenyl)diazenyl]-4-phenylthiophen-2-yl]amino]ethyl methanesulfonate (PubChem CID 136680538) has the molecular formula C21H16N6O5S2 and a molecular weight of 496.53 g/mol. Its IUPAC name is 2-[[3-cyano-5-[(2-cyano-4-nitrophenyl)diazenyl]-4-phenylthiophen-2-yl]amino]ethyl methanesulfonate.
| Compound Name | 2-[[3-cyano-5-[(2-cyano-4-nitrophenyl)diazenyl]-4-phenylthiophen-2-yl]amino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 136680538 |
| Molecular Formula | C21H16N6O5S2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 2-[[3-cyano-5-[(2-cyano-4-nitrophenyl)diazenyl]-4-phenylthiophen-2-yl]amino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCNc1sc(/N=N/c2ccc([N+](=O)[O-])cc2C#N)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C21H16N6O5S2/c1-34(30,31)32-10-9-24-20-17(13-23)19(14-5-3-2-4-6-14)21(33-20)26-25-18-8-7-16(27(28)29)11-15(18)12-22/h2-8,11,24H,9-10H2,1H3/b26-25+ |
| InChIKey | PQDJKYXVXBUJEZ-OCEACIFDSA-N |
| XLogP | 4.87 |
| TPSA | 170.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|