C28H21N5O6S3 — CID 136501380
3-[[5-amino-3-[4-(benzylamino)phenyl]-4-cyanothiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 136501380) has the molecular formula C28H21N5O6S3 and a molecular weight of 619.71 g/mol. Its IUPAC name is 3-[[5-amino-3-[4-(benzylamino)phenyl]-4-cyanothiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[5-amino-3-[4-(benzylamino)phenyl]-4-cyanothiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 136501380 |
| Molecular Formula | C28H21N5O6S3 |
| Molecular Weight | 619.71 g/mol |
| Exact Mass | 619.07 |
| IUPAC Name | 3-[[5-amino-3-[4-(benzylamino)phenyl]-4-cyanothiophen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | N#Cc1c(N)sc(/N=N/c2cc(S(=O)(=O)O)c3cccc(S(=O)(=O)O)c3c2)c1-c1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H21N5O6S3/c29-15-23-26(18-9-11-19(12-10-18)31-16-17-5-2-1-3-6-17)28(40-27(23)30)33-32-20-13-22-21(25(14-20)42(37,38)39)7-4-8-24(22)41(34,35)36/h1-14,31H,16,30H2,(H,34,35,36)(H,37,38,39)/b33-32+ |
| InChIKey | LTIYOVMIQNDQIW-ULIFNZDWSA-N |
| XLogP | 6.54 |
| TPSA | 195.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.71 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|