C19H27N3O2S — CID 136502286
1-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-[2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl]thiourea (PubChem CID 136502286) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-[2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl]thiourea.
| Compound Name | 1-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-[2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl]thiourea |
|---|---|
| PubChem CID | 136502286 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-[2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl]thiourea |
| SMILES | COc1cc(/C=N/NC(=S)NC(C)(C)[C@H]2CC=C(C)CC2)ccc1O |
| InChI | InChI=1S/C19H27N3O2S/c1-13-5-8-15(9-6-13)19(2,3)21-18(25)22-20-12-14-7-10-16(23)17(11-14)24-4/h5,7,10-12,15,23H,6,8-9H2,1-4H3,(H2,21,22,25)/b20-12+/t15-/m0/s1 |
| InChIKey | RJIPEKIDWKPVED-SLDJAQPHSA-N |
| XLogP | 3.72 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|