C21H20N4OS — CID 136503346
2-(2,3-dihydro-1H-inden-1-ylimino)-N-(1,3-thiazol-2-ylmethyl)-1,4-dihydro-3,1-benzoxazin-6-amine (PubChem CID 136503346) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-ylimino)-N-(1,3-thiazol-2-ylmethyl)-1,4-dihydro-3,1-benzoxazin-6-amine.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-ylimino)-N-(1,3-thiazol-2-ylmethyl)-1,4-dihydro-3,1-benzoxazin-6-amine |
|---|---|
| PubChem CID | 136503346 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-ylimino)-N-(1,3-thiazol-2-ylmethyl)-1,4-dihydro-3,1-benzoxazin-6-amine |
| SMILES | c1ccc2c(c1)CCC2/N=C1/Nc2ccc(NCc3nccs3)cc2CO1 |
| InChI | InChI=1S/C21H20N4OS/c1-2-4-17-14(3-1)5-7-19(17)25-21-24-18-8-6-16(11-15(18)13-26-21)23-12-20-22-9-10-27-20/h1-4,6,8-11,19,23H,5,7,12-13H2,(H,24,25) |
| InChIKey | QHRPZZWSJYICGT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|