C18H17ClN2O4 — CID 136506476
4-[5-chloro-2-hydroxy-3-[(4-methoxyphenyl)diazenyl]phenyl]-2-methylidenebutanoic acid (PubChem CID 136506476) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is 4-[5-chloro-2-hydroxy-3-[(4-methoxyphenyl)diazenyl]phenyl]-2-methylidenebutanoic acid.
| Compound Name | 4-[5-chloro-2-hydroxy-3-[(4-methoxyphenyl)diazenyl]phenyl]-2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 136506476 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-[5-chloro-2-hydroxy-3-[(4-methoxyphenyl)diazenyl]phenyl]-2-methylidenebutanoic acid |
| SMILES | C=C(CCc1cc(Cl)cc(/N=N/c2ccc(OC)cc2)c1O)C(=O)O |
| InChI | InChI=1S/C18H17ClN2O4/c1-11(18(23)24)3-4-12-9-13(19)10-16(17(12)22)21-20-14-5-7-15(25-2)8-6-14/h5-10,22H,1,3-4H2,2H3,(H,23,24)/b21-20+ |
| InChIKey | ORZBWLKFWKROPX-QZQOTICOSA-N |
| XLogP | 5.04 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|