C18H25FN2O2S — CID 136512166
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-(3-fluoro-4-methylsulfinylphenyl)urea (PubChem CID 136512166) has the molecular formula C18H25FN2O2S and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-(3-fluoro-4-methylsulfinylphenyl)urea.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-(3-fluoro-4-methylsulfinylphenyl)urea |
|---|---|
| PubChem CID | 136512166 |
| Molecular Formula | C18H25FN2O2S |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-(3-fluoro-4-methylsulfinylphenyl)urea |
| SMILES | CS(=O)c1ccc(NC(=O)NC2CCC3CCCCC3C2)cc1F |
| InChI | InChI=1S/C18H25FN2O2S/c1-24(23)17-9-8-15(11-16(17)19)21-18(22)20-14-7-6-12-4-2-3-5-13(12)10-14/h8-9,11-14H,2-7,10H2,1H3,(H2,20,21,22) |
| InChIKey | TYMKJLJXPMCAAD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |