C15H20N2O4S2 — CID 136515736
1-cyclohexyl-5-oxo-N-thiophen-3-ylsulfonylpyrrolidine-3-carboxamide (PubChem CID 136515736) has the molecular formula C15H20N2O4S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-cyclohexyl-5-oxo-N-thiophen-3-ylsulfonylpyrrolidine-3-carboxamide.
| Compound Name | 1-cyclohexyl-5-oxo-N-thiophen-3-ylsulfonylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 136515736 |
| Molecular Formula | C15H20N2O4S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 1-cyclohexyl-5-oxo-N-thiophen-3-ylsulfonylpyrrolidine-3-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccsc1)C1CC(=O)N(C2CCCCC2)C1 |
| InChI | InChI=1S/C15H20N2O4S2/c18-14-8-11(9-17(14)12-4-2-1-3-5-12)15(19)16-23(20,21)13-6-7-22-10-13/h6-7,10-12H,1-5,8-9H2,(H,16,19) |
| InChIKey | HJHCBWWGBSKPLL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |