C14H19ClN4O3 — CID 136518884
[1-[4-(3-chlorophenyl)piperazin-1-yl]-3-hydroxy-1-oxopropan-2-yl]urea (PubChem CID 136518884) has the molecular formula C14H19ClN4O3 and a molecular weight of 326.78 g/mol. Its IUPAC name is [1-[4-(3-chlorophenyl)piperazin-1-yl]-3-hydroxy-1-oxopropan-2-yl]urea.
| Compound Name | [1-[4-(3-chlorophenyl)piperazin-1-yl]-3-hydroxy-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 136518884 |
| Molecular Formula | C14H19ClN4O3 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [1-[4-(3-chlorophenyl)piperazin-1-yl]-3-hydroxy-1-oxopropan-2-yl]urea |
| SMILES | NC(=O)NC(CO)C(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H19ClN4O3/c15-10-2-1-3-11(8-10)18-4-6-19(7-5-18)13(21)12(9-20)17-14(16)22/h1-3,8,12,20H,4-7,9H2,(H3,16,17,22) |
| InChIKey | QJWJVDPCNIEOFS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |