C13H16ClIN2O2 — CID 136520804
1-(2-chloro-5-iodophenyl)-3-(oxepan-4-yl)urea (PubChem CID 136520804) has the molecular formula C13H16ClIN2O2 and a molecular weight of 394.64 g/mol. Its IUPAC name is 1-(2-chloro-5-iodophenyl)-3-(oxepan-4-yl)urea.
| Compound Name | 1-(2-chloro-5-iodophenyl)-3-(oxepan-4-yl)urea |
|---|---|
| PubChem CID | 136520804 |
| Molecular Formula | C13H16ClIN2O2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 1-(2-chloro-5-iodophenyl)-3-(oxepan-4-yl)urea |
| SMILES | O=C(Nc1cc(I)ccc1Cl)NC1CCCOCC1 |
| InChI | InChI=1S/C13H16ClIN2O2/c14-11-4-3-9(15)8-12(11)17-13(18)16-10-2-1-6-19-7-5-10/h3-4,8,10H,1-2,5-7H2,(H2,16,17,18) |
| InChIKey | FNSDWBOOUXISEC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|