C16H15FN2O — CID 136523218
N-[cyano-(4-fluorophenyl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 136523218) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is N-[cyano-(4-fluorophenyl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-[cyano-(4-fluorophenyl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 136523218 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-[cyano-(4-fluorophenyl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | N#CC(NC(=O)C1CC2C=CC1C2)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN2O/c17-13-5-3-11(4-6-13)15(9-18)19-16(20)14-8-10-1-2-12(14)7-10/h1-6,10,12,14-15H,7-8H2,(H,19,20) |
| InChIKey | SIDQHSSIUHJXMS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|