C16H24ClNO4S — CID 136537874
1-[1-(5-chloro-4-methoxy-2-methylphenyl)sulfonyl-4-methylpiperidin-2-yl]ethanol (PubChem CID 136537874) has the molecular formula C16H24ClNO4S and a molecular weight of 361.89 g/mol. Its IUPAC name is 1-[1-(5-chloro-4-methoxy-2-methylphenyl)sulfonyl-4-methylpiperidin-2-yl]ethanol.
| Compound Name | 1-[1-(5-chloro-4-methoxy-2-methylphenyl)sulfonyl-4-methylpiperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 136537874 |
| Molecular Formula | C16H24ClNO4S |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-[1-(5-chloro-4-methoxy-2-methylphenyl)sulfonyl-4-methylpiperidin-2-yl]ethanol |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCC(C)CC2C(C)O)cc1Cl |
| InChI | InChI=1S/C16H24ClNO4S/c1-10-5-6-18(14(7-10)12(3)19)23(20,21)16-9-13(17)15(22-4)8-11(16)2/h8-10,12,14,19H,5-7H2,1-4H3 |
| InChIKey | MFUVMDXRAJXICW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |