C15H18ClNO4S — CID 126822190
1-(5-chloro-4-methoxy-2-methylphenyl)sulfonyl-4-ethynylpiperidin-4-ol (PubChem CID 126822190) has the molecular formula C15H18ClNO4S and a molecular weight of 343.83 g/mol. Its IUPAC name is 1-(5-chloro-4-methoxy-2-methylphenyl)sulfonyl-4-ethynylpiperidin-4-ol.
| Compound Name | 1-(5-chloro-4-methoxy-2-methylphenyl)sulfonyl-4-ethynylpiperidin-4-ol |
|---|---|
| PubChem CID | 126822190 |
| Molecular Formula | C15H18ClNO4S |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-(5-chloro-4-methoxy-2-methylphenyl)sulfonyl-4-ethynylpiperidin-4-ol |
| SMILES | C#CC1(O)CCN(S(=O)(=O)c2cc(Cl)c(OC)cc2C)CC1 |
| InChI | InChI=1S/C15H18ClNO4S/c1-4-15(18)5-7-17(8-6-15)22(19,20)14-10-12(16)13(21-3)9-11(14)2/h1,9-10,18H,5-8H2,2-3H3 |
| InChIKey | IMRVNECHWUIQJH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|