C7H14N2O3S — CID 136538492
N-methyl-2-(3-methylazetidin-1-yl)-2-oxoethanesulfonamide (PubChem CID 136538492) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is N-methyl-2-(3-methylazetidin-1-yl)-2-oxoethanesulfonamide.
| Compound Name | N-methyl-2-(3-methylazetidin-1-yl)-2-oxoethanesulfonamide |
|---|---|
| PubChem CID | 136538492 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | N-methyl-2-(3-methylazetidin-1-yl)-2-oxoethanesulfonamide |
| SMILES | CNS(=O)(=O)CC(=O)N1CC(C)C1 |
| InChI | InChI=1S/C7H14N2O3S/c1-6-3-9(4-6)7(10)5-13(11,12)8-2/h6,8H,3-5H2,1-2H3 |
| InChIKey | FCPDDGXIRGEAGT-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |