About 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one
5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 136542470) has the molecular formula C15H17N5O2
and a molecular weight of 299.33 g/mol. Its IUPAC name is 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 136542470 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | COc1nc(C)cc(C)c1Cn1cnc2c(cnn2C)c1=O |
| InChI | InChI=1S/C15H17N5O2/c1-9-5-10(2)18-14(22-4)12(9)7-20-8-16-13-11(15(20)21)6-17-19(13)3/h5-6,8H,7H2,1-4H3 |
| InChIKey | DUYLZVPMUCSBHZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one (CID 136542470) is 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one is COc1nc(C)cc(C)c1Cn1cnc2c(cnn2C)c1=O.
What is the InChIKey of 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is DUYLZVPMUCSBHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O2/c1-9-5-10(2)18-14(22-4)12(9)7-20-8-16-13-11(15(20)21)6-17-19(13)3/h5-6,8H,7H2,1-4H3.
What are the key properties of 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 299.33 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 136542470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).