C13H12ClN5O — CID 63746275
5-[(2-amino-6-chlorophenyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 63746275) has the molecular formula C13H12ClN5O and a molecular weight of 289.73 g/mol. Its IUPAC name is 5-[(2-amino-6-chlorophenyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-[(2-amino-6-chlorophenyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 63746275 |
| Molecular Formula | C13H12ClN5O |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-[(2-amino-6-chlorophenyl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cn1ncc2c(=O)n(Cc3c(N)cccc3Cl)cnc21 |
| InChI | InChI=1S/C13H12ClN5O/c1-18-12-8(5-17-18)13(20)19(7-16-12)6-9-10(14)3-2-4-11(9)15/h2-5,7H,6,15H2,1H3 |
| InChIKey | RAIXSILARSHUSM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|