C17H22N4O4 — CID 136542546
3-[[2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetyl]amino]-N-ethyl-N-methylbenzamide (PubChem CID 136542546) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-[[2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetyl]amino]-N-ethyl-N-methylbenzamide.
| Compound Name | 3-[[2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetyl]amino]-N-ethyl-N-methylbenzamide |
|---|---|
| PubChem CID | 136542546 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3-[[2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetyl]amino]-N-ethyl-N-methylbenzamide |
| SMILES | CCN(C)C(=O)c1cccc(NC(=O)CN2C(=O)NC(=O)C2(C)C)c1 |
| InChI | InChI=1S/C17H22N4O4/c1-5-20(4)14(23)11-7-6-8-12(9-11)18-13(22)10-21-16(25)19-15(24)17(21,2)3/h6-9H,5,10H2,1-4H3,(H,18,22)(H,19,24,25) |
| InChIKey | KJHSZHNABQTQIT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|