C19H22N8O2 — CID 136553335
1-[3-(6-aminopurin-9-yl)propanoyl]-N-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 136553335) has the molecular formula C19H22N8O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-[3-(6-aminopurin-9-yl)propanoyl]-N-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | 1-[3-(6-aminopurin-9-yl)propanoyl]-N-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 136553335 |
| Molecular Formula | C19H22N8O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[3-(6-aminopurin-9-yl)propanoyl]-N-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | Nc1ncnc2c1ncn2CCC(=O)N1CCCC(C(=O)Nc2ccccn2)C1 |
| InChI | InChI=1S/C19H22N8O2/c20-17-16-18(23-11-22-17)27(12-24-16)9-6-15(28)26-8-3-4-13(10-26)19(29)25-14-5-1-2-7-21-14/h1-2,5,7,11-13H,3-4,6,8-10H2,(H2,20,22,23)(H,21,25,29) |
| InChIKey | BXMGVACNFUHOHZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |