C19H20N4OS — CID 136553434
4-[4-(thieno[2,3-c]pyridin-2-ylmethyl)piperazin-1-yl]benzamide (PubChem CID 136553434) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-[4-(thieno[2,3-c]pyridin-2-ylmethyl)piperazin-1-yl]benzamide.
| Compound Name | 4-[4-(thieno[2,3-c]pyridin-2-ylmethyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 136553434 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 4-[4-(thieno[2,3-c]pyridin-2-ylmethyl)piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2CCN(Cc3cc4ccncc4s3)CC2)cc1 |
| InChI | InChI=1S/C19H20N4OS/c20-19(24)14-1-3-16(4-2-14)23-9-7-22(8-10-23)13-17-11-15-5-6-21-12-18(15)25-17/h1-6,11-12H,7-10,13H2,(H2,20,24) |
| InChIKey | UXEAELREIJRARB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |