C17H18ClN3O3 — CID 136555141
2-(4-chlorophenyl)-N-(5,6-dimethoxy-3-pyridinyl)azetidine-1-carboxamide (PubChem CID 136555141) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(5,6-dimethoxy-3-pyridinyl)azetidine-1-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-(5,6-dimethoxy-3-pyridinyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 136555141 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(5,6-dimethoxy-3-pyridinyl)azetidine-1-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCC2c2ccc(Cl)cc2)cnc1OC |
| InChI | InChI=1S/C17H18ClN3O3/c1-23-15-9-13(10-19-16(15)24-2)20-17(22)21-8-7-14(21)11-3-5-12(18)6-4-11/h3-6,9-10,14H,7-8H2,1-2H3,(H,20,22) |
| InChIKey | KXHDWIWZSUFLDP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |