C14H16FN3O4S — CID 136558313
ethyl 4-[(4-fluoro-2-methylphenyl)sulfonylamino]-2-methyl-1H-imidazole-5-carboxylate (PubChem CID 136558313) has the molecular formula C14H16FN3O4S and a molecular weight of 341.36 g/mol. Its IUPAC name is ethyl 4-[(4-fluoro-2-methylphenyl)sulfonylamino]-2-methyl-1H-imidazole-5-carboxylate.
| Compound Name | ethyl 4-[(4-fluoro-2-methylphenyl)sulfonylamino]-2-methyl-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 136558313 |
| Molecular Formula | C14H16FN3O4S |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | ethyl 4-[(4-fluoro-2-methylphenyl)sulfonylamino]-2-methyl-1H-imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)nc1NS(=O)(=O)c1ccc(F)cc1C |
| InChI | InChI=1S/C14H16FN3O4S/c1-4-22-14(19)12-13(17-9(3)16-12)18-23(20,21)11-6-5-10(15)7-8(11)2/h5-7,18H,4H2,1-3H3,(H,16,17) |
| InChIKey | UBXWYMUGBJRYDT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |