C17H23FN4O2 — CID 136558664
tert-butyl N-[2-[[(1-ethylpyrazol-4-yl)amino]methyl]-4-fluorophenyl]carbamate (PubChem CID 136558664) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[(1-ethylpyrazol-4-yl)amino]methyl]-4-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(1-ethylpyrazol-4-yl)amino]methyl]-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 136558664 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | tert-butyl N-[2-[[(1-ethylpyrazol-4-yl)amino]methyl]-4-fluorophenyl]carbamate |
| SMILES | CCn1cc(NCc2cc(F)ccc2NC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C17H23FN4O2/c1-5-22-11-14(10-20-22)19-9-12-8-13(18)6-7-15(12)21-16(23)24-17(2,3)4/h6-8,10-11,19H,5,9H2,1-4H3,(H,21,23) |
| InChIKey | PNQGTDMNLXUZPA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |