C14H29N3O4S — CID 136558897
1,1-dimethyl-3-[2-[[2-methyl-2-(oxan-2-yl)propyl]sulfonylamino]ethyl]urea (PubChem CID 136558897) has the molecular formula C14H29N3O4S and a molecular weight of 335.47 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[[2-methyl-2-(oxan-2-yl)propyl]sulfonylamino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[[2-methyl-2-(oxan-2-yl)propyl]sulfonylamino]ethyl]urea |
|---|---|
| PubChem CID | 136558897 |
| Molecular Formula | C14H29N3O4S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1,1-dimethyl-3-[2-[[2-methyl-2-(oxan-2-yl)propyl]sulfonylamino]ethyl]urea |
| SMILES | CN(C)C(=O)NCCNS(=O)(=O)CC(C)(C)C1CCCCO1 |
| InChI | InChI=1S/C14H29N3O4S/c1-14(2,12-7-5-6-10-21-12)11-22(19,20)16-9-8-15-13(18)17(3)4/h12,16H,5-11H2,1-4H3,(H,15,18) |
| InChIKey | OSLQNLVEKKHYDR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|