C8H10Cl2N2O3S — CID 136561823
N-(3,3-dichlorocyclobutyl)-3-methyl-1,2-oxazole-4-sulfonamide (PubChem CID 136561823) has the molecular formula C8H10Cl2N2O3S and a molecular weight of 285.15 g/mol. Its IUPAC name is N-(3,3-dichlorocyclobutyl)-3-methyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(3,3-dichlorocyclobutyl)-3-methyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 136561823 |
| Molecular Formula | C8H10Cl2N2O3S |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | N-(3,3-dichlorocyclobutyl)-3-methyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1nocc1S(=O)(=O)NC1CC(Cl)(Cl)C1 |
| InChI | InChI=1S/C8H10Cl2N2O3S/c1-5-7(4-15-11-5)16(13,14)12-6-2-8(9,10)3-6/h4,6,12H,2-3H2,1H3 |
| InChIKey | QXIKRKGTNATKLF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|