About 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide
3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide (PubChem CID 138018139) has the molecular formula C9H11N3O4S
and a molecular weight of 257.27 g/mol. Its IUPAC name is 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide |
| PubChem CID | 138018139 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1nocc1S(=O)(=O)NCc1ocnc1C |
| InChI | InChI=1S/C9H11N3O4S/c1-6-8(15-5-10-6)3-11-17(13,14)9-4-16-12-7(9)2/h4-5,11H,3H2,1-2H3 |
| InChIKey | UZOVNVROAJNDDB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide?
The IUPAC name of 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide (CID 138018139) is 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide?
The canonical SMILES for 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide is Cc1nocc1S(=O)(=O)NCc1ocnc1C.
What is the InChIKey of 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide?
The InChIKey is UZOVNVROAJNDDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O4S/c1-6-8(15-5-10-6)3-11-17(13,14)9-4-16-12-7(9)2/h4-5,11H,3H2,1-2H3.
What are the key properties of 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide?
3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide has a molecular weight of 257.27 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[(4-methyl-1,3-oxazol-5-yl)methyl]-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 138018139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).