About 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide
4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide (PubChem CID 136562958) has the molecular formula C20H28N2O3
and a molecular weight of 344.45 g/mol. Its IUPAC name is 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide |
| PubChem CID | 136562958 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide |
| SMILES | CC1(C)Cc2cccc(NC(=O)N3CCC(O)(C4CCC4)CC3)c2O1 |
| InChI | InChI=1S/C20H28N2O3/c1-19(2)13-14-5-3-8-16(17(14)25-19)21-18(23)22-11-9-20(24,10-12-22)15-6-4-7-15/h3,5,8,15,24H,4,6-7,9-13H2,1-2H3,(H,21,23) |
| InChIKey | SZFXTUYFZAXVLU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide?
The IUPAC name of 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide (CID 136562958) is 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide.
What is the SMILES notation for 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide?
The canonical SMILES for 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide is CC1(C)Cc2cccc(NC(=O)N3CCC(O)(C4CCC4)CC3)c2O1.
What is the InChIKey of 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide?
The InChIKey is SZFXTUYFZAXVLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2O3/c1-19(2)13-14-5-3-8-16(17(14)25-19)21-18(23)22-11-9-20(24,10-12-22)15-6-4-7-15/h3,5,8,15,24H,4,6-7,9-13H2,1-2H3,(H,21,23).
What are the key properties of 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide?
4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide has a molecular weight of 344.45 g/mol, XLogP of 3.56, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclobutyl-N-(2,2-dimethyl-3H-1-benzofuran-7-yl)-4-hydroxypiperidine-1-carboxamide is sourced from PubChem (CID 136562958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).