C17H17N3O2S — CID 136571987
4-[4-[2-(oxolan-3-ylmethoxy)phenyl]pyrazol-1-yl]-1,3-thiazole (PubChem CID 136571987) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-[4-[2-(oxolan-3-ylmethoxy)phenyl]pyrazol-1-yl]-1,3-thiazole.
| Compound Name | 4-[4-[2-(oxolan-3-ylmethoxy)phenyl]pyrazol-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 136571987 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-[4-[2-(oxolan-3-ylmethoxy)phenyl]pyrazol-1-yl]-1,3-thiazole |
| SMILES | c1ccc(-c2cnn(-c3cscn3)c2)c(OCC2CCOC2)c1 |
| InChI | InChI=1S/C17H17N3O2S/c1-2-4-16(22-10-13-5-6-21-9-13)15(3-1)14-7-19-20(8-14)17-11-23-12-18-17/h1-4,7-8,11-13H,5-6,9-10H2 |
| InChIKey | MOVMUKIUWJLEQM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |