C16H24N4O2 — CID 136585499
(3aR,6aS)-N-(1-ethyl-6-oxo-3-pyridinyl)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 136585499) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (3aR,6aS)-N-(1-ethyl-6-oxo-3-pyridinyl)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aS)-N-(1-ethyl-6-oxo-3-pyridinyl)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 136585499 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (3aR,6aS)-N-(1-ethyl-6-oxo-3-pyridinyl)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CCn1cc(NC(=O)N2C[C@@H]3CN(C)C[C@]3(C)C2)ccc1=O |
| InChI | InChI=1S/C16H24N4O2/c1-4-19-9-13(5-6-14(19)21)17-15(22)20-8-12-7-18(3)10-16(12,2)11-20/h5-6,9,12H,4,7-8,10-11H2,1-3H3,(H,17,22)/t12-,16+/m0/s1 |
| InChIKey | SJCJJGVQYXUDCH-BLLLJJGKSA-N |
| XLogP | 1.28 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |