C15H18F2N2O3S — CID 136585637
(3aR,6aS)-N-[3-(1,1-difluoroethyl)phenyl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide (PubChem CID 136585637) has the molecular formula C15H18F2N2O3S and a molecular weight of 344.38 g/mol. Its IUPAC name is (3aR,6aS)-N-[3-(1,1-difluoroethyl)phenyl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aS)-N-[3-(1,1-difluoroethyl)phenyl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 136585637 |
| Molecular Formula | C15H18F2N2O3S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (3aR,6aS)-N-[3-(1,1-difluoroethyl)phenyl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide |
| SMILES | CC(F)(F)c1cccc(NC(=O)N2C[C@@H]3CS(=O)(=O)C[C@@H]3C2)c1 |
| InChI | InChI=1S/C15H18F2N2O3S/c1-15(16,17)12-3-2-4-13(5-12)18-14(20)19-6-10-8-23(21,22)9-11(10)7-19/h2-5,10-11H,6-9H2,1H3,(H,18,20)/t10-,11+ |
| InChIKey | JWCSKNPOCULFMD-PHIMTYICSA-N |
| XLogP | 2.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |