C19H22N2O2 — CID 136586705
[(3aS,6R,6aR)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-(5-benzyl-1H-pyrrol-2-yl)methanone (PubChem CID 136586705) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is [(3aS,6R,6aR)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-(5-benzyl-1H-pyrrol-2-yl)methanone.
| Compound Name | [(3aS,6R,6aR)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-(5-benzyl-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 136586705 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | [(3aS,6R,6aR)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-(5-benzyl-1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1ccc(Cc2ccccc2)[nH]1)N1CC[C@@H]2CC[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C19H22N2O2/c22-17-9-6-14-10-11-21(18(14)17)19(23)16-8-7-15(20-16)12-13-4-2-1-3-5-13/h1-5,7-8,14,17-18,20,22H,6,9-12H2/t14-,17+,18+/m0/s1 |
| InChIKey | SWHUTKMFZXRLOY-BMGDILEWSA-N |
| XLogP | 2.59 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |