C14H16N2O3S — CID 136587597
N-[(3R,4R)-4-methoxyoxan-3-yl]thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 136587597) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[(3R,4R)-4-methoxyoxan-3-yl]thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[(3R,4R)-4-methoxyoxan-3-yl]thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 136587597 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-[(3R,4R)-4-methoxyoxan-3-yl]thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CO[C@@H]1CCOC[C@H]1NC(=O)c1cc2ccncc2s1 |
| InChI | InChI=1S/C14H16N2O3S/c1-18-11-3-5-19-8-10(11)16-14(17)12-6-9-2-4-15-7-13(9)20-12/h2,4,6-7,10-11H,3,5,8H2,1H3,(H,16,17)/t10-,11-/m1/s1 |
| InChIKey | BJWZPGUYRHKKLJ-GHMZBOCLSA-N |
| XLogP | 1.83 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |