C13H18F3NO4S — CID 136587948
[(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-[(2R)-oxolan-2-yl]methanone (PubChem CID 136587948) has the molecular formula C13H18F3NO4S and a molecular weight of 341.35 g/mol. Its IUPAC name is [(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-[(2R)-oxolan-2-yl]methanone.
| Compound Name | [(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-[(2R)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 136587948 |
| Molecular Formula | C13H18F3NO4S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-[(2R)-oxolan-2-yl]methanone |
| SMILES | O=C([C@H]1CCCO1)N1C[C@@H]2[C@@](C(F)(F)F)(CCCS2(=O)=O)C1 |
| InChI | InChI=1S/C13H18F3NO4S/c14-13(15,16)12-4-2-6-22(19,20)10(12)7-17(8-12)11(18)9-3-1-5-21-9/h9-10H,1-8H2/t9-,10-,12-/m1/s1 |
| InChIKey | IPNFKFUEKPZKIG-CKYFFXLPSA-N |
| XLogP | 1.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |